| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 6,7-Dimethoxy-4-methylcoumarin Basic information |
| Product Name: | 6,7-Dimethoxy-4-methylcoumarin | | Synonyms: | TIMTEC-BB SBB006391;4-METHYL-6,7-DIMETHOXYCOUMARIN;DIMETHOXY-4-METHYLCOUMARIN,6,7-(RG);DIMETHOXY-4-METHYLCOUMARIN,6,7-;6,7-DIMETHOXY-4-METHYLCOUMARIN, FOR FLUO RESCENCE;6,7-dimethoxy-4-methyl-chromen-2-one;6,7-dimethoxy-4-methylchromen-2-one;NSC 688797 | | CAS: | 4281-40-7 | | MF: | C12H12O4 | | MW: | 220.22 | | EINECS: | | | Product Categories: | Heterocyclic Building Blocks;Fluorescent Labels and Indicators;Fluorescent Labels & Indicators;Fluorescent Enzyme Substrates for Flow CytometryBiochemicals and Reagents;Luminescent Compounds/Detection;Stains and Dyes;Fluorescent Enzyme Substrates for Flow Cytometry;Building Blocks;CoumarinsFluorescent Probes, Labels, Particles and Stains;Fluorescent Enzyme Substrates | | Mol File: | 4281-40-7.mol |  |
| | 6,7-Dimethoxy-4-methylcoumarin Chemical Properties |
| Melting point | 136-139 °C (lit.) | | Boiling point | 374.5±42.0 °C(Predicted) | | density | 1.202±0.06 g/cm3(Predicted) | | solubility | DMSO: soluble | | form | powder to crystal | | color | White to Orange to Green | | λmax | 340nm(MeOH)(lit.) | | BRN | 189644 | | InChI | 1S/C12H12O4/c1-7-4-12(13)16-9-6-11(15-3)10(14-2)5-8(7)9/h4-6H,1-3H3 | | InChIKey | GBYDSYPGGDKWGZ-UHFFFAOYSA-N | | SMILES | COc1cc2OC(=O)C=C(C)c2cc1OC | | CAS DataBase Reference | 4281-40-7(CAS DataBase Reference) |
| WGK Germany | 3 | | F | 8 | | HS Code | 2932209088 | | Storage Class | 11 - Combustible Solids |
| | 6,7-Dimethoxy-4-methylcoumarin Usage And Synthesis |
| Uses | 6,7-Dimethoxy-4-methylcoumarin (cas# 4281-40-7) is a compound useful in organic synthesis. | | Definition | ChEBI: 6,7-dimethoxy-4-methylchromen-2-one is a member of coumarins. |
| | 6,7-Dimethoxy-4-methylcoumarin Preparation Products And Raw materials |
|