|
|
| | 2,2,6-Trimethyl-4-chromanone Basic information |
| Product Name: | 2,2,6-Trimethyl-4-chromanone | | Synonyms: | 2,2,6-Trimethyl-4-chromanone;4H-1-Benzopyran-4-one, 2,3-dihydro-2,2,6-trimethyl-;2,3-dihydro-2,2,6-trimethylchromen-4-one;2,2,6-Trimethyl-2,3-dihydro-4H-chromen-4-one | | CAS: | 63678-14-8 | | MF: | C12H14O2 | | MW: | 190.24 | | EINECS: | | | Product Categories: | | | Mol File: | 63678-14-8.mol |  |
| | 2,2,6-Trimethyl-4-chromanone Chemical Properties |
| Melting point | 67 °C(Solv: ethanol (64-17-5)) | | Boiling point | 304.7±42.0 °C(Predicted) | | density | 1.065±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C12H14O2/c1-8-4-5-11-9(6-8)10(13)7-12(2,3)14-11/h4-6H,7H2,1-3H3 | | InChIKey | MWCLIHHFUUYVDF-UHFFFAOYSA-N | | SMILES | O=C(C1)C2=CC(C)=CC=C2OC1(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2,2,6-Trimethyl-4-chromanone Usage And Synthesis |
| | 2,2,6-Trimethyl-4-chromanone Preparation Products And Raw materials |
|