|
|
| | 4,5-Di-O-caffeoylquinic acid methyl ester Basic information |
| Product Name: | 4,5-Di-O-caffeoylquinic acid methyl ester | | Synonyms: | 4,5-Di-O-caffeoylquinic acid methyl ester;Cyclohexanecarboxylic acid, 3,4-bis[[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,5-dihydroxy-, methyl ester, (1R,3R,4S,5R)-;4,5-O-Dicaffeoyl quinic acid methyl ester | | CAS: | 188742-80-5 | | MF: | C26H26O12 | | MW: | 530.48 | | EINECS: | | | Product Categories: | | | Mol File: | 188742-80-5.mol |  |
| | 4,5-Di-O-caffeoylquinic acid methyl ester Chemical Properties |
| Boiling point | 740.7±60.0 °C(Predicted) | | density | 1.56±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 9.32±0.10(Predicted) | | form | solid | | biological source | plant | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | PKJBSZTYNDRXEQ-GMGOHGFSSA-N | | SMILES | O([C@@H]2[C@@H](C[C@@](C[C@H]2O)(O)C(=O)OC)OC(=O)\C=C\c3cc(c(cc3)O)O)C(=O)\C=C\c1cc(c(cc1)O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4,5-Di-O-caffeoylquinic acid methyl ester Usage And Synthesis |
| Uses | It is a natural product derived from plant source th at finds application in compound screening libraries, metabolomics, phytochemical, and pharmaceutical research. | | Biological Activity | 4,5-Di-O-caffeoylquinic acid methyl ester demonstrates strong antioxidant activity with significant free radical-scavenging abilities against DPPH. Additionally, it displays in vitro antiviral activity against the respiratory syncytial virus. |
| | 4,5-Di-O-caffeoylquinic acid methyl ester Preparation Products And Raw materials |
|