| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | Ixazomib Impurity 1 Basic information |
| Product Name: | Ixazomib Impurity 1 | | Synonyms: | Ixazomib Impurity 1;2,5-dichloro-N-(2-(((R)-3-methyl-1-((3aS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborol-2-yl)butyl)amino)-2-oxoethyl)benzamide;2,5-Dichloro-N-[2-[[(1R)-1-[(3aS,4S,6S,7aR)-hexahydro-3a,5,5-trimethyl-4,6-methano-1,3,2-benzodioxaborol-2-yl]-3-methylbutyl]amino]-2-oxoethyl]-benzamide;Benzamide, 2,5-dichloro-N-[2-[[(1R)-1-[(3aS,4S,6S,7aR)-hexahydro-3a,5,5-trimethyl-4,6-methano-1,3,2-benzodioxaborol-2-yl]-3-methylbutyl]amino]-2-oxoethyl]-;Ixazomib Impurity R;Ixazomib Impurity N1;2,5-Dichloro-N-[2-({(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]dec-4-yl]butyl}amino)-2-oxoethyl]benzamide;2,5-dichloro-N-(2-(((R)-3-methyl-1-((3aS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborol-2-yl)butyl)amino)-2-oxoethyl)benzamide/ Ixazomib Impurity 1 | | CAS: | 1201903-02-7 | | MF: | C24H33BCl2N2O4 | | MW: | 495.25 | | EINECS: | | | Product Categories: | | | Mol File: | 1201903-02-7.mol |  |
| | Ixazomib Impurity 1 Chemical Properties |
| Boiling point | 602.0±55.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Dichloromethane; Chloroform; Methanol; Ethyl Acetate; DMSO; | | form | Solid | | pka | 12.10±0.46(Predicted) | | color | White | | InChIKey | CGUIBVMGUKXODV-OPKBTAHXSA-N | | SMILES | C(NCC(N[C@H](B1O[C@@]2(C)[C@@]3([H])C[C@@]([H])(C[C@@]2([H])O1)C3(C)C)CC(C)C)=O)(=O)C1=CC(Cl)=CC=C1Cl |
| | Ixazomib Impurity 1 Usage And Synthesis |
| Uses | 2,5-Dichloro-N-[2-[[(1R)-1-[(3aS,4S,6S,7aR)-hexahydro-3a,5,5-trimethyl-4,6-methano-1,3,2-benzodioxaborol-2-yl]-3-methylbutyl]amino]-2-oxoethyl]-benzamide is an intermediate used in the synthesis of Ixazomib (I942000), which is a proteasome inhibitor that acts by preventing cell growth in solid tumours. It is an anticancer agent that is used to treat patients with multiple myeloma and is potentially neurotoxic. |
| | Ixazomib Impurity 1 Preparation Products And Raw materials |
|