|
|
| | 4,8-BIS(HYDROXYMETHYL)TRICYCLO[5.2.1.0(2,6)]DECANE Basic information | | Preparation |
| Product Name: | 4,8-BIS(HYDROXYMETHYL)TRICYCLO[5.2.1.0(2,6)]DECANE | | Synonyms: | BIS(HYDROXYMETHYL)TRICYCLO[5.2.1.02,6]DECANE;4,8-BIS(HYDROXYMETHYL)TRICYCLO[5.2.1.0(2,6)]DECANE;TRICYCLO[5.2.1.0(2,6)]DECANE-4,8-DIMETHANOL;TRICYCLO[5.2.1.02,6]DECANEDIMETHANOL;TRICYCLO[5.2.1.02'6]DECANEDIMETHANOL;TRICYCLO[5.2.1.0]DECANEDIMETHANOL;4,8-bis(hydroxymethyl)tricyclo(5.2.1.o/2,6)decan;tricyclo(5.2.1.02,7)decane-4,8-dimethanol | | CAS: | 26896-48-0 | | MF: | C12H20O2 | | MW: | 196.29 | | EINECS: | 248-096-5 | | Product Categories: | | | Mol File: | 26896-48-0.mol | ![4,8-BIS(HYDROXYMETHYL)TRICYCLO[5.2.1.0(2,6)]DECANE Structure](CAS/GIF/26896-48-0.gif) |
| | 4,8-BIS(HYDROXYMETHYL)TRICYCLO[5.2.1.0(2,6)]DECANE Chemical Properties |
| Boiling point | 175 °C | | density | 1.136[at 20℃] | | vapor pressure | 1hPa at 20℃ | | refractive index | n20/D 1.528(lit.) | | Fp | >230 °F | | storage temp. | Store at room temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Odor | at 100.00 %. sweet amber musk floral sandalwood | | Odor Type | amber | | Water Solubility | 11g/L at 20℃ | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1/C12H20O2/c13-5-7-1-10-8-3-9(6-14)11(4-8)12(10)2-7/h7-14H,1-6H2/t7,8-,9,10,11-,12/s3 | | InChIKey | ZFZDWMXUMXACHS-QBGFXIPLNA-N | | SMILES | C12CC(CO)CC1[C@@]1([H])C[C@]2([H])CC1CO |&1:7,10,r| | | LogP | 2.1 | | EPA Substance Registry System | Tricyclodecanedimethanol (26896-48-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36 | | Safety Statements | 26-36/37/39 | | WGK Germany | 1 | | RTECS | PC0475000 | | TSCA | TSCA listed | | HS Code | 2906.19.5000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 |
| | 4,8-BIS(HYDROXYMETHYL)TRICYCLO[5.2.1.0(2,6)]DECANE Usage And Synthesis |
| Preparation | 4,8-BIS(HYDROXYMETHYL)TRICYCLO[5.2.1.0(2,6)]DECANE is a hydroformylation product. Its synthesis methods include one-step and two-step methods. The one-step method involves the hydroformylation of dicyclopentadiene (DCPD) to synthesize the product. The two-step method involves the hydroformylation of dicyclopentadiene to synthesize 4,8-BIS(HYDROXYMETHYL)TRICYCLO[5.2.1.0(2,6)]DECANE, followed by hydrogenation to obtain the final product. | | Uses | 4,8-Bis(hydroxymethyl)tricyclo[5.2.1.02,6]decane (TDMol) is used in the preparation of high molecular weight poly(1,4-butylene carbonate) (PBC). It is also used in the synthesis of photoactive compounds (PAC) for the preparation of positive photo-resist materials. | | Application | 4,8-Bis(hydroxymethyl)tricyclo[5.2.1.02,6]decane (TDMol) is used for production of di(meth)acrylates that are used in UV/EB-curing applications for adhesives, inks, electronics, and coatings. The (meth)acrylate has good wetting properties, that is why it is used in pigmented UV-curable inks, and a higher refractive index than many other acrylates, hence it is often used in electronics and optical applications, where a higher refractive index is required.
| | Flammability and Explosibility | Non flammable |
| | 4,8-BIS(HYDROXYMETHYL)TRICYCLO[5.2.1.0(2,6)]DECANE Preparation Products And Raw materials |
|