| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,3,4,5,6-Pentafluorophenoxyacetyl chloride Basic information |
| | 2,3,4,5,6-Pentafluorophenoxyacetyl chloride Chemical Properties |
| Boiling point | 116-117°C 20mm | | density | 1.6038 (estimate) | | refractive index | 1.451-1.453 | | Fp | 116-117°C/20mm | | form | solid | | InChI | 1S/C8H2ClF5O2/c9-2(15)1-16-8-6(13)4(11)3(10)5(12)7(8)14/h1H2 | | InChIKey | WQLJMPAQIWVNGS-UHFFFAOYSA-N | | SMILES | Fc1c(F)c(F)c(OCC(Cl)=O)c(F)c1F | | CAS DataBase Reference | 55502-53-9(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-14 | | Safety Statements | 36/37/39-3/7-27-26 | | RIDADR | 3265 | | WGK Germany | WGK 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29189990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,3,4,5,6-Pentafluorophenoxyacetyl chloride Usage And Synthesis |
| Chemical Properties | CLEAR PALE YELLOW LIQUID |
| | 2,3,4,5,6-Pentafluorophenoxyacetyl chloride Preparation Products And Raw materials |
|