| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | 1-(4-bromobutyl)-4-methoxybenzene Basic information | | Uses |
| | 1-(4-bromobutyl)-4-methoxybenzene Chemical Properties |
| Boiling point | 135 °C(Press: 2.5 Torr) | | density | 1.263±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C11H15BrO/c1-13-11-7-5-10(6-8-11)4-2-3-9-12/h5-8H,2-4,9H2,1H3 | | InChIKey | ORLVTTVUPUULCW-UHFFFAOYSA-N | | SMILES | C1(CCCCBr)=CC=C(OC)C=C1 |
| | 1-(4-bromobutyl)-4-methoxybenzene Usage And Synthesis |
| Uses | 1-(4-bromobutyl)-4-methoxybenzene is used as an organic synthesis intermediate and can be used to prepare substances such as glycosides, polymer molecules and diphenylalkyl halides. |
| | 1-(4-bromobutyl)-4-methoxybenzene Preparation Products And Raw materials |
|