|
|
| | 4-(4-Methoxyphenyl)-1-butanol Basic information |
| | 4-(4-Methoxyphenyl)-1-butanol Chemical Properties |
| Melting point | 3-4 °C(lit.) | | Boiling point | 160-161 °C8 mm Hg(lit.) | | density | 1.042 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.526(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 15.15±0.10(Predicted) | | form | Oil | | color | Clear Colourless | | InChI | InChI=1S/C11H16O2/c1-13-11-7-5-10(6-8-11)4-2-3-9-12/h5-8,12H,2-4,9H2,1H3 | | InChIKey | ONIBHZIXCLTLNO-UHFFFAOYSA-N | | SMILES | C1(CCCCO)=CC=C(OC)C=C1 | | CAS DataBase Reference | 52244-70-9(CAS DataBase Reference) | | NIST Chemistry Reference | 4-(4-Methoxyphenyl)-1-butanol(52244-70-9) |
| WGK Germany | 3 | | HS Code | 2909309090 | | Storage Class | 11 - Combustible Solids |
| | 4-(4-Methoxyphenyl)-1-butanol Usage And Synthesis |
| Chemical Properties | light yellow liquid | | Uses | 4-(4-Methoxyphenyl)-1-butanol is used as a reactant in nonimidazole histamine H3 receptor ligands preparation with combined inhibitory histamine N-methyltransferase activity. | | General Description | Decay of 4-(4-methoxyphenyl)-1-butanol radical cation in water via Cα-H deprotonation has been kinetically investigated by pulse radiolysis. |
| | 4-(4-Methoxyphenyl)-1-butanol Preparation Products And Raw materials |
|