| Company Name: |
RS LIFE SCIENCES
|
| Tel: |
+91-9963585741 |
| Email: |
vvr@rslifesciences.com |
| Products Intro: |
Product Name:2,2-Dibromo-1-(2-chlorophenyl)ethanone CAS:34356-83-7 Purity:97 Package:10kg;INR
|
| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Tulobuterol Impurity 3 CAS:34356-83-7 Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Hubei Yangxin Medical Technology Co., Ltd.
|
| Tel: |
15374522761 |
| Email: |
3003392093@yongstandards.com |
| Products Intro: |
Product Name:Tulobuterol Impurity 3 CAS:34356-83-7 Purity:99%+ HPLC Package:10mg;25mg;50mg;100mg
|
|
| | Tulobuterol Impurity Basic information |
| Product Name: | Tulobuterol Impurity | | Synonyms: | Tulobuterol Impurity 3;Ethanone, 2,2-dibromo-1-(2-chlorophenyl)-;2,2-Dibromo-1-(2-chlorophenyl)ethanone;Tulobuterol Impurity N6;Tuloterol Impurity 4;T1101-Z2 | | CAS: | 34356-83-7 | | MF: | C8H5Br2ClO | | MW: | 312.39 | | EINECS: | | | Product Categories: | | | Mol File: | 34356-83-7.mol |  |
| | Tulobuterol Impurity Chemical Properties |
| Boiling point | 276.6±25.0 °C(Predicted) | | density | 1.956±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C8H5Br2ClO/c9-8(10)7(12)5-3-1-2-4-6(5)11/h1-4,8H | | InChIKey | ZIJBOKNENCASCS-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=CC=C1Cl)C(Br)Br |
| | Tulobuterol Impurity Usage And Synthesis |
| | Tulobuterol Impurity Preparation Products And Raw materials |
|