| Company Name: |
ChemeGen Gold |
| Tel: |
18818260767 |
| Email: |
2625930290@qq.com |
- PIK-inhibitors
-
- $573.00
-
2026-07-27
- CAS:371934-59-7
- Purity: 96.98%
- Supply Ability: 10g
|
| | PIK-inhibitors Basic information |
| Product Name: | PIK-inhibitors | | Synonyms: | PIK-inhibitors;MDK34597 PIK-inhibitors;MDK34597 (PI3K inhibitor);3-[4-(MORPHOLIN-4-YL)PYRIDO[3',2':4,5]FURO[3,2-D]PYRIMIDIN-2-YL]ANILINE;PIK-inhibitors(p110α-IN-1);p110α-IN-1;P110Α-IN-1;MDK34597;MDK34597; MDK-34597; MDK 34597. PI3K INHIBITOR | | CAS: | 371934-59-7 | | MF: | C19H17N5O2 | | MW: | 347.37 | | EINECS: | | | Product Categories: | | | Mol File: | 371934-59-7.mol |  |
| | PIK-inhibitors Chemical Properties |
| density | 1.383±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: soluble | | form | A crystalline solid | | pka | 3.31±0.10(Predicted) | | color | Light yellow to light brown | | InChI | InChI=1S/C19H17N5O2/c20-13-4-1-3-12(11-13)17-22-15-14-5-2-6-21-19(14)26-16(15)18(23-17)24-7-9-25-10-8-24/h1-6,11H,7-10,20H2 | | InChIKey | RQPKSOWRJPRYCN-UHFFFAOYSA-N | | SMILES | C1(N)=CC=CC(C2=NC(N3CCOCC3)=C3OC4=NC=CC=C4C3=N2)=C1 |
| | PIK-inhibitors Usage And Synthesis |
| Uses | PI3K-IN-32 (compound 35) is a potent PI3K p110α inhibitor with an pIC50 of 6.85[1]. | | References | [1] Li Y, et al. Pharmacophore modeling and 3D-QSAR analysis of phosphoinositide 3-kinase p110alpha inhibitors. J Mol Model. 2010 Sep;16(9):1449-60. DOI:10.1007/s00894-010-0659-y |
| | PIK-inhibitors Preparation Products And Raw materials |
|