| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Roark Standards |
| Tel: |
0755-83552066 15986688328 |
| Email: |
service@roarkstandards.com |
|
| | Sorafenib Impurity 13 Basic information |
| Product Name: | Sorafenib Impurity 13 | | Synonyms: | N-Desmethyl Sorafenib (Pyridine)-N-oxide;Sorafenib N-Desmethyl N-Oxide;Sorafenib Impurity 44(Sorafenib N-Desmethyl N-Oxide);BAY 68-7769;2-Pyridinecarboxamide, 4-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-, 1-oxide;Sorafenib Impurity 44;4,6-bis(4-(3-(4-chloro-3-(trifluoromethyl)phenyl)ureido)phenoxy)-N-methylpicolinamide | | CAS: | 583840-04-4 | | MF: | C20H14ClF3N4O4 | | MW: | 466.8 | | EINECS: | | | Product Categories: | | | Mol File: | 583840-04-4.mol |  |
| | Sorafenib Impurity 13 Chemical Properties |
| InChI | InChI=1S/C20H14ClF3N4O4/c21-16-6-3-12(9-15(16)20(22,23)24)27-19(30)26-11-1-4-13(5-2-11)32-14-7-8-28(31)17(10-14)18(25)29/h1-10H,(H2,25,29)(H2,26,27,30) | | InChIKey | VYTLLTTWWZIYME-UHFFFAOYSA-N | | SMILES | C1(C(N)=O)[N+]([O-])=CC=C(OC2=CC=C(NC(NC3=CC=C(Cl)C(C(F)(F)F)=C3)=O)C=C2)C=1 |
| | Sorafenib Impurity 13 Usage And Synthesis |
| Uses | N-Desmethyl Sorafenib (Pyridine)-N-oxide is a metabolite of Sorafenib (S676850) and has anti-proliferative activity in human breast cancer cells. |
| | Sorafenib Impurity 13 Preparation Products And Raw materials |
|