2,6-Difluoroanilino(oxo)acetic acid manufacturers
|
| | 2,6-Difluoroanilino(oxo)acetic acid Basic information |
| Product Name: | 2,6-Difluoroanilino(oxo)acetic acid | | Synonyms: | 2-((2,6-Difluorophenyl)Amino)-2-Oxoacetic Acid;2,6-Difluoroanilino(oxo)acetic acid;Acetic acid, 2-[(2,6-difluorophenyl)amino]-2-oxo-;[(2,6-Difluorophenyl)carbamoyl]formic acid;2-((2,6-Difluorophenyl)Amino)-2-Oxoace;2-((2,6-difluorophenyl)amino)-2-oxoacetic acid(WXC05446);[(2,6-difluorophenyl)carbamoyl]formic acid - [D92246] | | CAS: | 1018295-42-5 | | MF: | C8H5F2NO3 | | MW: | 201.13 | | EINECS: | | | Product Categories: | | | Mol File: | 1018295-42-5.mol |  |
| | 2,6-Difluoroanilino(oxo)acetic acid Chemical Properties |
| density | 1.601±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, sealed storage, away from moisture | | form | powder | | pka | 2.73±0.40(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C8H5F2NO3/c9-4-2-1-3-5(10)6(4)11-7(12)8(13)14/h1-3H,(H,11,12)(H,13,14) | | InChIKey | XKMPHIMGYLKQKV-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(NC1=C(F)C=CC=C1F)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2,6-Difluoroanilino(oxo)acetic acid Usage And Synthesis |
| Uses | 2,6-Difluoroanilino(oxo)acetic acid is a potent catalyst renowned for its utility in various organic reactions.
| | reaction suitability | core: palladium
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
| | 2,6-Difluoroanilino(oxo)acetic acid Preparation Products And Raw materials |
|