| Company Name: |
cjbscvictory Gold |
| Tel: |
13348960310 13348960310 |
| Email: |
3003867561@qq.com |
Epiberberine (chloride) manufacturers
|
| | Epiberberine (chloride) Basic information |
| | Epiberberine (chloride) Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMSO:25.0(Max Conc. mg/mL);67.24(Max Conc. mM) | | form | Solid | | color | Orange to Very Dark Orange | | Stability: | Light Sensitive | | InChI | InChI=1S/C20H18NO4.ClH/c1-22-18-8-13-5-6-21-10-15-12(3-4-17-20(15)25-11-24-17)7-16(21)14(13)9-19(18)23-2;/h3-4,7-10H,5-6,11H2,1-2H3;1H/q+1;/p-1 | | InChIKey | DGRBIBRPLDAHJH-UHFFFAOYSA-M | | SMILES | O(C1=C(C=C2CC[N+]3=CC4C5OCOC=5C=CC=4C=C3C2=C1)OC)C.[Cl-] |
| | Epiberberine (chloride) Usage And Synthesis |
| Uses | Epiberberine Chloride, is a natural bioactive alkaloid, an isomer of Berberine (B318150), an isoqinoline alkaloid shown to have a chemopreventive property against colon tumor formation by inhibiting the enzyme cyclooxygenase-2 (cox-2) which is abundantly expressed in colon cancer cells. | | in vivo | Epiberberine (225 mg/kg, p.o. daily for 40 days) reduces body weight, food consumption, water intake, and urinary output of KK-Ay mice[3]. | | IC 50 | AChE; BACE1; BChE |
| | Epiberberine (chloride) Preparation Products And Raw materials |
|