| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Palmatine chloride hydrate manufacturers
|
| | Palmatine chloride hydrate Basic information |
| Product Name: | Palmatine chloride hydrate | | Synonyms: | KIT DNA/RNA EZ-96 1X96 TESTS;PALMATINE CHLORIDE HYDRATE;PALMATINECHLORIDE95%;PalMatine chloride hydrate 97%;Hydrochloric PalMatine;2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium;5,6-Dihydro-2,3,9,10-tetramethoxydibenzo[a,g]quinoliziniumchloridehydrate(1:1:1);BUFFER SP2 | | CAS: | 171869-95-7 | | MF: | C21H24ClNO5 | | MW: | 405.87 | | EINECS: | | | Product Categories: | Building Blocks;Chemical Synthesis;Heterocyclic Building Blocks;Building Blocks;Heterocyclic Building Blocks;Isoquinolines | | Mol File: | 171869-95-7.mol |  |
| | Palmatine chloride hydrate Chemical Properties |
| Melting point | 206-207 °C (dec.)(lit.) | | Fp | >230 °F | | InChI | 1S/C21H22NO4.ClH.H2O/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4;;/h5-6,9-12H,7-8H2,1-4H3;1H;1H2/q+1;;/p-1 | | InChIKey | PIQNSCSNSSZUIT-UHFFFAOYSA-M | | SMILES | [Cl-].[H]O[H].COc1cc2CC[n+]3cc4c(OC)c(OC)ccc4cc3-c2cc1OC |
| Hazard Codes | Xn | | Risk Statements | 20/22-36/38 | | Safety Statements | 24-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2 |
| | Palmatine chloride hydrate Usage And Synthesis |
| Uses | Palmatine chloride hydrate (Palmatine) is suitable for use:
- as alkaloid standard in the method validation for determination of berberine, hydrastine and canadine in goldenseal (Hydrastis canadensis L.) root powder
- in the preparation of 8-heteroaryl-7,8-dihydroprotoberberine
- in a study to investigate the FT-Raman and surface-enhanced Raman scattering (SERS) spectra of three related alkaloid dyes, namely palmatine, jatrorrhizine and coptisine
| | General Description | Palmatine chloride hydrate (Palmatine) is an alkaloid. It is a potential phototoxin, and exhibits low quantum yields for fluorescence. Normal Raman spectra and DFT calculations of palmatine chloride hydrate is reported. |
| | Palmatine chloride hydrate Preparation Products And Raw materials |
|