|
|
| | Methyl 1,2,5,6-Tetrahydropyridine-3-carboxylate Hydrochloride Basic information |
| Product Name: | Methyl 1,2,5,6-Tetrahydropyridine-3-carboxylate Hydrochloride | | Synonyms: | Methyl 1,2,5,6-Tetrahydropyridine-3-carboxylate Hydrochloride;methyl 1,2,3,6-tetrahydropyridine-5-carboxylate,hydrochloride;Guvacoline HCl;mAChR,Inhibitor,Guvacoline hydrochloride,Guvacoline,inhibit,Muscarinic acetylcholine receptor;Guvacoline hydrochloride;Norarecoline hydrochloride | | CAS: | 6197-39-3 | | MF: | C7H12ClNO2 | | MW: | 177.62868 | | EINECS: | | | Product Categories: | | | Mol File: | 6197-39-3.mol |  |
| | Methyl 1,2,5,6-Tetrahydropyridine-3-carboxylate Hydrochloride Chemical Properties |
| Melting point | 121-122 °C | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO | | form | Solid | | color | Light yellow | | Major Application | food and beverages
pharmaceutical | | InChI | InChI=1S/C7H11NO2.ClH/c1-10-7(9)6-3-2-4-8-5-6;/h3,8H,2,4-5H2,1H3;1H | | InChIKey | ZWALOEQHJRUTKM-UHFFFAOYSA-N | | SMILES | C1NCCC=C1C(OC)=O.[H]Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Methyl 1,2,5,6-Tetrahydropyridine-3-carboxylate Hydrochloride Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from betel nut. | | Uses | Guvacoline Hydrochloride is an intermediate in the synthesis of N-Nitrosoguvacoline (N527625), one of the N-nitrosation products of arecoline. It is the only one N-nitrosamine found in Taiwanese betel quid chewing saliva. It is used as a standard for the determination of Nitrosamine in tobacco smoke. |
| | Methyl 1,2,5,6-Tetrahydropyridine-3-carboxylate Hydrochloride Preparation Products And Raw materials |
|