- Guvacine
-
-
2024-04-12
- CAS:498-96-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000ton
|
| | Guvacine Basic information |
| Product Name: | Guvacine | | Synonyms: | GUVACINE;1,2,5,6-tetrahydro-3-pyridinecarboxylic acid;1,2,5,6-TETRAHYDROPYRIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE;GUVACINE-HCL;1,2,5,6-tetrahydronicotinic acid;1,2,5,6-tetrahydropyridine-3-carboxylic acid(SALTDATA: HCl);1,2,5,6-Tetrahydropyridine-3-carboxylic acid;3-Pyridinecarboxylic acid, 1,2,5,6-tetrahydro- | | CAS: | 498-96-4 | | MF: | C6H9NO2 | | MW: | 127.14 | | EINECS: | | | Product Categories: | GABA/Glycine receptor | | Mol File: | 498-96-4.mol |  |
| | Guvacine Chemical Properties |
| Melting point | 295°C (rough estimate) | | Boiling point | 235.91°C (rough estimate) | | density | 1.1931 (rough estimate) | | refractive index | 1.4645 (estimate) | | storage temp. | Store at RT | | solubility | H2O: soluble | | form | solid | | pka | 3.61±0.20(Predicted) | | color | white | | InChI | InChI=1S/C6H9NO2/c8-6(9)5-2-1-3-7-4-5/h2,7H,1,3-4H2,(H,8,9) | | InChIKey | QTDZOWFRBNTPQR-UHFFFAOYSA-N | | SMILES | C1NCCC=C1C(O)=O | | CAS DataBase Reference | 498-96-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT |
| | Guvacine Usage And Synthesis |
| Uses | Guvacine Hydrochloride is a GABA uptake inhibitor (hGABA T-1, rGABA T-2, hGABA T-3 and hBGT-1) (1,2,3). Gamma-Aminobutyric acid (GABA) is the major inhibitory neurotransmitter in the mammalian brain (4). Guvacine Hydrochloride may be useful for treating neuropsychiatric disorders. | | Definition | ChEBI: A alpha,beta-unsaturated monocarboxylic acid that is nicotinic acid which has been hydrogenated at the 1-2 and 5-6 positions of the pyridine ring. | | Biological Activity | Specific GABA uptake inhibitor. IC 50 values are 14, 58, 119 and 1870 mM for hGAT-1, rGAT-2, hGAT-3 and hBGT-1 respectively. |
| | Guvacine Preparation Products And Raw materials |
|