|
|
| | 2-(N-Ethyl-m-toluidino)ethanol Basic information |
| Product Name: | 2-(N-Ethyl-m-toluidino)ethanol | | Synonyms: | 2-(N-ETHYL-M-TOLUIDINO)ETHANOL;3-METHYL-N-ETHYL-N-BETA-HYDROXYETHYLANILINE;3-METHYL-N-ETHYL-N'-HYDROXYETHYLANILINE;N-ETHYL-N-HYDROXYETHYL-META-TOLUIDINE;N-ETHYL-N-HYDROXYETHYL-M-TOLUIDINE;N-ETHYL-N-(2'-HYDROXYETHYL)-3-TOLUIDINE;N-ETHYL-N-(2-HYDROXYETHYL)-M-TOLUIDINE;2-(ethyl(m-tolyl)amino)ethanol | | CAS: | 91-88-3 | | MF: | C11H17NO | | MW: | 179.26 | | EINECS: | 202-105-9 | | Product Categories: | Indazoles;Intermediates of Dyes and Pigments | | Mol File: | 91-88-3.mol |  |
| | 2-(N-Ethyl-m-toluidino)ethanol Chemical Properties |
| Melting point | -19 °C | | Boiling point | 114-115 °C/1 mmHg (lit.) | | density | 1.019 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.555(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | powder to lump to clear liquid | | pka | 14.67±0.10(Predicted) | | color | White or Colorless to Yellow to Orange | | Water Solubility | insoluble | | InChI | InChI=1S/C11H17NO/c1-3-12(7-8-13)11-6-4-5-10(2)9-11/h4-6,9,13H,3,7-8H2,1-2H3 | | InChIKey | KRNUKKZDGDAWBF-UHFFFAOYSA-N | | SMILES | C(O)CN(CC)C1=CC=CC(C)=C1 | | CAS DataBase Reference | 91-88-3(CAS DataBase Reference) | | NIST Chemistry Reference | Ethanol, 2-[ethyl(3-methylphenyl)amino]-(91-88-3) | | EPA Substance Registry System | 2-(N-Ethyl-m-toluidino)ethanol (91-88-3) |
| | 2-(N-Ethyl-m-toluidino)ethanol Usage And Synthesis |
| Chemical Properties | clear yellow to green liquid | | Uses | A 2-(N-Ethyl-m-toluidino)ethanol pigment system and lipoprotein lipase are used as a new glycerol oxidase determination method for serum triglyceride. 2-(N-Ethyl-m-toluidino)ethanol is also used in quantitative structure–activity relationship (QSAR) models that are developed to predict the aquatic toxicity of chemicals to the fathead minnow (Pimephales promelas). | | Uses | 2-(N-Ethyl-N-m-toluidino)ethanol may be used in chemical synthesis studies. | | Definition | ChEBI: 2-(n-ethyl-n-m-toluidino)ethanol is an aminotoluene. |
| | 2-(N-Ethyl-m-toluidino)ethanol Preparation Products And Raw materials |
|