Methyl 4-(methylamino)butanoate manufacturers
|
| | Methyl 4-(methylamino)butanoate Basic information |
| | Methyl 4-(methylamino)butanoate Chemical Properties |
| InChI | InChI=1S/C6H13NO2/c1-7-5-3-4-6(8)9-2/h7H,3-5H2,1-2H3 | | InChIKey | NCHRVWIOGHJADK-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCCNC |
| | Methyl 4-(methylamino)butanoate Usage And Synthesis |
| Synthesis | 4- (methylamino) butyric acid Cl was dissolved in methanol, and thionyl chloride in catalytic amount was added drop by drop. The reaction mixture was stirred at 0 °C for 30 min. The solvent was reduced in vacu, yielding a white solid Methyl 4-(methylamino)butanoate.
|
| | Methyl 4-(methylamino)butanoate Preparation Products And Raw materials |
|