| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Chloro-4-methylphenol Basic information |
| | 3-Chloro-4-methylphenol Chemical Properties |
| Melting point | 48-53 °C | | Boiling point | 228 °C | | density | 0,963g/cm | | refractive index | 1,403 | | Fp | 228°C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | powder to lump | | pka | 9.30±0.18(Predicted) | | color | Light yellow to Amber to Dark green | | λmax | 283nm(H2O)(lit.) | | InChI | InChI=1S/C7H7ClO/c1-5-2-3-6(9)4-7(5)8/h2-4,9H,1H3 | | InChIKey | VQZRLBWPEHFGCD-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(C)C(Cl)=C1 | | CAS DataBase Reference | 615-62-3(CAS DataBase Reference) | | EPA Substance Registry System | Phenol, 3-chloro-4-methyl- (615-62-3) |
| Hazard Codes | C,T,Xi,Xn | | Risk Statements | 20/21/22-36/37/38-38-21/22-41-37/38 | | Safety Statements | 23-36/37/39-28-26-39 | | RIDADR | 3437 | | WGK Germany | 3 | | Hazard Note | Toxic/Corrosive | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 29089990 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 3-Chloro-4-methylphenol Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 3-Chloro-4-methylphenol is used in preparation of (Carbonyl)benzylthiadiazoles as herbicides. | | Synthesis Reference(s) | Tetrahedron Letters, 24, p. 2077, 1983 DOI: 10.1016/S0040-4039(00)81848-1 |
| | 3-Chloro-4-methylphenol Preparation Products And Raw materials |
|