| Company Name: |
Cdreamlab (Hubei) Technology Co., LTD
|
| Tel: |
0717-6300888 18062399888 |
| Email: |
service@cdreamlab.com |
| Products Intro: |
Product Name:3-trimethoxysilylpropyl 3-oxobutanoate
CAS:121505-13-3
Purity:>=95% Package:100MG;100G;10KG;1T
|
|
| | Butanoic acid, 3-oxo-, 3-(trimethoxysilyl)propyl ester Basic information |
| | Butanoic acid, 3-oxo-, 3-(trimethoxysilyl)propyl ester Chemical Properties |
| Boiling point | 284.2±20.0 °C(Predicted) | | density | 1.061±0.06 g/cm3(Predicted) | | pka | 10?+-.0.46(Predicted) | | InChI | InChI=1S/C10H20O6Si/c1-9(11)8-10(12)16-6-5-7-17(13-2,14-3)15-4/h5-8H2,1-4H3 | | InChIKey | JLZKEFNAFBDTIM-UHFFFAOYSA-N | | SMILES | C(OCCC[Si](OC)(OC)OC)(=O)CC(=O)C |
| | Butanoic acid, 3-oxo-, 3-(trimethoxysilyl)propyl ester Usage And Synthesis |
| Uses |
Butanoic acid, 3-oxo-, 3-(trimethoxysilyl)propyl ester is used for polarizing plates, polarizing plates and optical display device films.
|
| | Butanoic acid, 3-oxo-, 3-(trimethoxysilyl)propyl ester Preparation Products And Raw materials |
|