2-Propenoic acid, 2-methyl-, 1-ethoxyethyl ester manufacturers
|
| | 2-Propenoic acid, 2-methyl-, 1-ethoxyethyl ester Basic information |
| Product Name: | 2-Propenoic acid, 2-methyl-, 1-ethoxyethyl ester | | Synonyms: | 2-Propenoic acid, 2-methyl-, 1-ethoxyethyl ester;1-ethoxyethyl methacrylate;51920-52-6 2-Propenoic acid, 2-methyl-, 1-ethoxyethyl ester;1-ethoxyethyl2-methylprop-2-enoate;DK799;1-Ethanol-ethanol methacrylate;1-Ethoxyethyl Methacrylate (stabilized with MEHQ) | | CAS: | 51920-52-6 | | MF: | C8H14O3 | | MW: | 158.2 | | EINECS: | | | Product Categories: | monomer | | Mol File: | 51920-52-6.mol |  |
| | 2-Propenoic acid, 2-methyl-, 1-ethoxyethyl ester Chemical Properties |
| Boiling point | 180.5±23.0 °C(Predicted) | | density | 0.954±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C8H14O3/c1-5-10-7(4)11-8(9)6(2)3/h7H,2,5H2,1,3-4H3 | | InChIKey | HVBADOTWUFBZMF-UHFFFAOYSA-N | | SMILES | C(OC(OCC)C)(=O)C(C)=C |
| | 2-Propenoic acid, 2-methyl-, 1-ethoxyethyl ester Usage And Synthesis |
| Uses | 2-Propenoic acid, 2-methyl-, 1-ethoxyethyl ester is used as a photoresist monomer. |
| | 2-Propenoic acid, 2-methyl-, 1-ethoxyethyl ester Preparation Products And Raw materials |
|