| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Ethyl 5-(4-chlorophenyl)isoxazole-3-carboxylate Basic information |
| Product Name: | Ethyl 5-(4-chlorophenyl)isoxazole-3-carboxylate | | Synonyms: | 5-(4-chloro-phenyl)-isoxazole-3-carboxylic acid ethyl ester;3-(4-Chloro-phenyl)-isoxazole-5-carboxylic acid ethylester;3-Isoxazolecarboxylic acid, 5-(4-chlorophenyl)-, ethyl ester;Ethyl 5-(4-chlorophenyl)isoxazole-3-carboxylate | | CAS: | 81282-12-4 | | MF: | C12H10ClNO3 | | MW: | 251.67 | | EINECS: | | | Product Categories: | | | Mol File: | 81282-12-4.mol |  |
| | Ethyl 5-(4-chlorophenyl)isoxazole-3-carboxylate Chemical Properties |
| Melting point | 127-128 °C(Solv: ethanol (64-17-5)) | | Boiling point | 405.4±35.0 °C(Predicted) | | density | 1.276±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -6.61±0.38(Predicted) | | form | solid | | InChI | 1S/C12H10ClNO3/c1-2-16-12(15)10-7-11(17-14-10)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3 | | InChIKey | CJQWCZKLLDAKCX-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cc(on1)-c2ccc(Cl)cc2 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Ethyl 5-(4-chlorophenyl)isoxazole-3-carboxylate Usage And Synthesis |
| | Ethyl 5-(4-chlorophenyl)isoxazole-3-carboxylate Preparation Products And Raw materials |
|