| Company Name: |
Shanghai Yuqing Chemical Co., Ltd. Gold
|
| Tel: |
+86-13816254020 +86-18601759286 |
| Email: |
penny.xu@tianqing-chem.com |
| Products Intro: |
Product Name:N,N'-Diemthyl-N-Methyllisonipecotamide CAS:613678-09-4 Package:1kg/
|
N,N'-Diemthyl-N-Methyllisonipecotamide manufacturers
|
| | N,N'-Diemthyl-N-Methyllisonipecotamide Basic information |
| | N,N'-Diemthyl-N-Methyllisonipecotamide Chemical Properties |
| Boiling point | 260.4±29.0 °C(Predicted) | | density | 0.986±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 8.57±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H18N2O/c1-10(2)9(12)8-4-6-11(3)7-5-8/h8H,4-7H2,1-3H3 | | InChIKey | MORFIZKYBRXBGO-UHFFFAOYSA-N | | SMILES | N1(C)CCC(C(N(C)C)=O)CC1 |
| | N,N'-Diemthyl-N-Methyllisonipecotamide Usage And Synthesis |
| | N,N'-Diemthyl-N-Methyllisonipecotamide Preparation Products And Raw materials |
|