| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:3,4-DIMETHYLHEXANE
CAS:583-48-2
|
|
| | 3,4-DIMETHYLHEXANE Basic information |
| Product Name: | 3,4-DIMETHYLHEXANE | | Synonyms: | 3,4-dimethyl-hexan;C2H5CH(CH3)CH(CH3)C2H5;3,4-DIMETHYLHEXANE;3,4-DIMETHYLHEXANE, STANDARD FOR GC;Inchi=1/C8H18/C1-5-7(3)8(4)6-2/H7-8H,5-6H2,1-4h;3,4-Dimethylhexane >;3,4-DIMETHYLHEXANE ISO 9001：2015 REACH;3,4-Dimethylhexane in methanol | | CAS: | 583-48-2 | | MF: | C8H18 | | MW: | 114.23 | | EINECS: | 209-504-7 | | Product Categories: | DID - DINChemical Class;Hydrocarbons;Neats;Acyclic;Alkanes;Organic Building Blocks;Alphabetic;D | | Mol File: | 583-48-2.mol |  |
| | 3,4-DIMETHYLHEXANE Chemical Properties |
| Melting point | -91.46°C (estimate) | | Boiling point | 119 °C (lit.) | | density | 0.72 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.403(lit.) | | Fp | 44 °F | | color | Colorless to Almost colorless | | Water Solubility | 799.4ug/L(temperature not stated) | | BRN | 1718744 | | Henry's Law Constant | 2.2×10-6 mol/(m3Pa) at 25℃, Yaws (2003) | | Exposure limits | ACGIH: TWA 300 ppm | | InChI | 1S/C8H18/c1-5-7(3)8(4)6-2/h7-8H,5-6H2,1-4H3 | | InChIKey | RNTWWGNZUXGTAX-UHFFFAOYSA-N | | SMILES | CCC(C)C(C)CC | | LogP | 4.471 (est) | | CAS DataBase Reference | 583-48-2(CAS DataBase Reference) | | EPA Substance Registry System | 3,4-Dimethylhexane (583-48-2) |
| Hazard Codes | F,Xn | | Risk Statements | 11-36/37/38-65 | | Safety Statements | 16-26-36-62 | | RIDADR | UN 1262 3/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2901.10.5000 | | HazardClass | 3.1 | | PackingGroup | II | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Asp. Tox. 1
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,4-DIMETHYLHEXANE Usage And Synthesis |
| Uses | 3,4-Dimethylhexane may be used to study the mechanism of addition of hydrogen to 1-butene. |
| | 3,4-DIMETHYLHEXANE Preparation Products And Raw materials |
|