| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | 2,5-Diethoxy-benzene-1,4-dicarbaldehyde Basic information |
| Product Name: | 2,5-Diethoxy-benzene-1,4-dicarbaldehyde | | Synonyms: | 2,5-Diethoxy-benzene-1,4-dicarbaldehyde;2,5-Diethoxyterephthalaldehyde;1,4-Benzenedicarboxaldehyde, 2,5-diethoxy-;2,5-Diethoxy-benzene-1,4-dicarbaldehyde ISO 9001:2015 REACH;2,5-Diethoxy-1,4-benzenedicarboxaldehyde;2,5-diethoxyparabenzenedialdehyde | | CAS: | 56766-03-1 | | MF: | C12H14O4 | | MW: | 222.24 | | EINECS: | | | Product Categories: | | | Mol File: | 56766-03-1.mol |  |
| | 2,5-Diethoxy-benzene-1,4-dicarbaldehyde Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C12H14O4/c1-3-15-11-5-10(8-14)12(16-4-2)6-9(11)7-13/h5-8H,3-4H2,1-2H3 | | InChIKey | DDCDZJHDWYGVRO-UHFFFAOYSA-N | | SMILES | C1(C=O)=CC(OCC)=C(C=O)C=C1OCC |
| | 2,5-Diethoxy-benzene-1,4-dicarbaldehyde Usage And Synthesis |
| | 2,5-Diethoxy-benzene-1,4-dicarbaldehyde Preparation Products And Raw materials |
|