| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Norbornene-2-endo,3-endo-dimethanol Basic information |
| Product Name: | 5-Norbornene-2-endo,3-endo-dimethanol | | Synonyms: | 5-ENDO,6-ENDO-BIS(HYDROXYMETHYL)-2-NORBORNENE;(endo,endo)-bicyclo[2.2.1]hept-5-ene-2,3-dimethanol;bicyclo[2.2.1]hept-5-ene-2,3-dimethanol,(endo,endo)-;Bicyclo[2.2.1]hept-5-ene-2,3-dimethanol,(1R,2S,3R,4S)-rel-;[(1R,2S,3R,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol;rel-(1R,2S,3R,4S)-Bicyclo[2.2.1]hept-5-ene-2,3-dimethanol;5-Norbornene-2-E;BICYCLO[2.2.1]HEPT-5-ENE-2-ENDO,3-ENDO-DIMETHANOL | | CAS: | 699-97-8 | | MF: | C9H14O2 | | MW: | 154.21 | | EINECS: | | | Product Categories: | Alicyclic/Etch-Resistant Monomers;Lithography Monomers;Self Assembly&Contact Printing;Norbornene Derivatives | | Mol File: | 699-97-8.mol |  |
| | 5-Norbornene-2-endo,3-endo-dimethanol Chemical Properties |
| Melting point | 86 °C | | Boiling point | 130 °C / 1mmHg | | density | 1.0182 (rough estimate) | | refractive index | 1.5230 (estimate) | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 14.62±0.10(Predicted) | | color | White to Almost white | | InChI | 1S/C9H14O2/c10-4-8-6-1-2-7(3-6)9(8)5-11/h1-2,6-11H,3-5H2/t6-,7+,8-,9+ | | InChIKey | IGHHPVIMEQGKNE-SPJNRGJMSA-N | | SMILES | OC[C@@H]1[C@H]2C[C@H](C=C2)[C@@H]1CO |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2906.19.5000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Norbornene-2-endo,3-endo-dimethanol Usage And Synthesis |
| | 5-Norbornene-2-endo,3-endo-dimethanol Preparation Products And Raw materials |
|