| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Methylbenzyl triphenylphosphonium chloride Basic information |
| Product Name: | 4-Methylbenzyl triphenylphosphonium chloride | | Synonyms: | (P-METHYLBENZYL)TRIPHENYLPHOSPHONIUM CHLORIDE;[(4-METHYLPHENYL)METHYL]-TRIPHENYLPHOSPHONIUM CHLORIDE;4-Methylbenzyl triphenylphosphonium chloride, 98+%;4-Methylbenzyltriphenylphosphonium chloride,99%;(4-methylphenyl)methyl-triphenylphosphanium,chloride;(4-Methylbenzyl)triphenylphosphonium chloride - [M89897];4-Methylbenzyl triphenylphosphonium chloride | | CAS: | 1530-37-6 | | MF: | C26H24ClP | | MW: | 402.9 | | EINECS: | | | Product Categories: | | | Mol File: | 1530-37-6.mol |  |
| | 4-Methylbenzyl triphenylphosphonium chloride Chemical Properties |
| Melting point | 262-264 °C | | storage temp. | 2-8°C, sealed storage, away from moisture | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C26H24P.ClH/c1-22-17-19-23(20-18-22)21-27(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26;/h2-20H,21H2,1H3;1H/q+1;/p-1 | | InChIKey | AZHSDLYDKBEFLL-UHFFFAOYSA-M | | SMILES | [P+](CC1C=CC(C)=CC=1)(C1=CC=CC=C1)(C1C=CC=CC=1)C1C=CC=CC=1.[Cl-] |
| | 4-Methylbenzyl triphenylphosphonium chloride Usage And Synthesis |
| Chemical Properties | WHITE CRYSTALLINE POWDER |
| | 4-Methylbenzyl triphenylphosphonium chloride Preparation Products And Raw materials |
|