|
|
| | (-)-B-METHOXYDIISOPINOCAMPHEYLBORANE Basic information |
| Product Name: | (-)-B-METHOXYDIISOPINOCAMPHEYLBORANE | | Synonyms: | (+)-B-methoxydiisocamphenylborane;(-)-B-METHOXYDIISOPINOCAMPHEYLBORANE;(-)-B-METHOXYDIISOPINOCAMPHEYLBORANE HYDRATE;(-)-DIISOPINOCAMPHEYLMETHOXYBORANE HYDRATE;(+)-B-Methoxydiisopinocampheylborane;(+)-B-Methoxydiisopinocampheylborane,(+)-Diisopinocampheylmethoxyborane;(-)-beta-Methoxydiisopinocampheylboranehydrate;Borinic acid, B,B-bis[(1S,2R,3S,5S)-2,6,6-trimethylbicyclo[3.1.1]hept-3-yl]-, methyl ester | | CAS: | 99438-28-5 | | MF: | C21H37BO | | MW: | 316.33 | | EINECS: | | | Product Categories: | | | Mol File: | 99438-28-5.mol |  |
| | (-)-B-METHOXYDIISOPINOCAMPHEYLBORANE Chemical Properties |
| Boiling point | 365.6±9.0 °C(Predicted) | | density | 0.95±0.1 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | solid | | Appearance | Colorless to light yellow Solid | | BRN | 6370228 | | InChI | InChI=1S/C21H37BO/c1-12-15-8-13(19(15,2)3)9-16(12)21(6)17-10-14(20(17,4)5)11-18(21)22-23-7/h12-18,22H,8-11H2,1-7H3/t12-,13+,14-,15+,16+,17+,18+,21-/m1/s1 | | InChIKey | BRIUCEGTDHQYCH-VSDAKGBHSA-N | | SMILES | B([C@H]1C[C@@]2([H])C[C@@]([H])(C2(C)C)[C@]1([C@H]1C[C@]2([H])C[C@]([H])(C2(C)C)[C@H]1C)C)OC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (-)-B-METHOXYDIISOPINOCAMPHEYLBORANE Usage And Synthesis |
| Uses | Reactant involved in:
- Oxidative cyclization and alkylation for synthesis of ionomycin
- Intramolecular conjugate addition for tetrahydropyran synthesis
- Aldol addition and Suzuki coupling reactions
- Allylation
- Synthesis of alkanols
| | Uses | (-)-B-Methoxydiisopinocampheylborane hydrate is an intermediate used in the synthesis of homoallylic alcohol''s and several complex natural products. | | Uses | (+)-B-Methoxydiisopinocampheylborane is a chiral catalyst used in synthetic organic chemistry such as the bacterial macrolide glycoside (-)-Lyngbyaloside B which maintains antiproliferative activity. |
| | (-)-B-METHOXYDIISOPINOCAMPHEYLBORANE Preparation Products And Raw materials |
|