|
|
| | 8-Aminoguanine Basic information |
| Product Name: | 8-Aminoguanine | | Synonyms: | 2,8-DIAMINO-1,9-DIHYDRO-PURIN-6-ONE;2,8-Diamino-1,9-dihydro-purin-6-one 2,8-Diaminohypoxanthine;2,8-DiaMinohypoxanthine;2,8-Diamino-1,7-dihydro-6H-purin-6-one;6H-Purin-6-one, 2,8-diamino-1,9-dihydro-;2,8-Diamino-1H-purin-6(7H)-one;8-Aminoguanine | | CAS: | 28128-41-8 | | MF: | C5H6N6O | | MW: | 166.14 | | EINECS: | | | Product Categories: | Nucleotides and Nucleosides;Bases & Related Reagents;Nucleotides | | Mol File: | 28128-41-8.mol |  |
| | 8-Aminoguanine Chemical Properties |
| Melting point | >330°C (dec.) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | Aqueous Base (Sparingly, Heated), DMSO (Very Slightly, Heated) | | form | powder | | color | white to beige | | InChI | 1S/C5H6N6O/c6-4-8-1-2(9-4)10-5(7)11-3(1)12/h(H6,6,7,8,9,10,11,12) | | InChIKey | WYDKPTZGVLTYPG-UHFFFAOYSA-N | | SMILES | O=C1C2=C(N=C(N)N2)NC(N)=N1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 8-Aminoguanine Usage And Synthesis |
| Chemical Properties | Solid | | Uses | 8-Aminoguanine accelerates DNA tetramolecular G-quadruplex formation. | | Biological Activity | 8-Aminoguanine, a guanine derivative, is an orally available and highly efficacious potassium-sparing diuretic/natriuretic th at increased sodium excretion by 17.2-fold and decrease potassium excretion by 71.0%. 8-Aminoguanine increases glucose excretion by 12.1-fold. Also, 8-Aminoguanine suppressed deoxycorticosterone/salt-induced hypertension. |
| | 8-Aminoguanine Preparation Products And Raw materials |
|