|
|
| | 2-Deoxy-D-[1-13C]arabino-hexose Basic information |
| | 2-Deoxy-D-[1-13C]arabino-hexose Chemical Properties |
| Boiling point | 146-147 °C(lit.) | | density | 1.415±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | Solid | | color | White to off-white | | InChI | 1S/C6H12O5/c7-2-4-6(10)3(8)1-5(9)11-4/h3-10H,1-2H2/t3-,4-,5,6+/m1/s1/i5+1 | | InChIKey | PMMURAAUARKVCB-UPKQYVFDSA-N | | SMILES | OC[C@H]1O[13CH](O)C[C@@H](O)[C@@H]1O | | CAS Number Unlabeled | 154-17-6 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Deoxy-D-[1-13C]arabino-hexose Usage And Synthesis |
| Uses | 2-Deoxy-D-glucose-1-13C is the isotope labelled analogue of 2-Deoxy-D-glucose (D239000), a tumor therapeutic and a targeted optical imaging agent for fluorescent in vivo imaging. |
| | 2-Deoxy-D-[1-13C]arabino-hexose Preparation Products And Raw materials |
|