| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | D-Mannose-1-13C Basic information |
| | D-Mannose-1-13C Chemical Properties |
| Melting point | 133 °C (lit.) | | density | 1.581±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | solid | | Optical Rotation | [α]20/D +14.5°, c = 1 in H2O | | InChI | 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5+,6/m1/s1/i6+1 | | InChIKey | WQZGKKKJIJFFOK-YILIOCFTSA-N | | SMILES | OC[C@H]1O[13CH](O)[C@@H](O)[C@@H](O)[C@@H]1O | | CAS Number Unlabeled | 3458-28-4 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D-Mannose-1-13C Usage And Synthesis |
| Uses | (D-Mannose-1-13C) D-Mannose is a carbohydrate that is important in the glycosylation of molecules in a variety of cellular processes. It is involved in N and O glycosylation of bovine why protein products, used in infant formulas. It is also responsible for the O-glycosylation of the T helper cell-derived cytokine interlukin-17A, an important cell-signaling molecule. This is the labeled analog. |
| | D-Mannose-1-13C Preparation Products And Raw materials |
|