- 2-Acetylphenothiazine
-
- $1.00
-
2020-01-09
- CAS:6631-94-3
- Min. Order: 1ASSAYS
- Purity: 85.0-99.8%
- Supply Ability: 20tons
|
| | 2-Acetylphenothiazine Basic information |
| | 2-Acetylphenothiazine Chemical Properties |
| Melting point | 180-185 °C (lit.) | | Boiling point | 455.7±34.0 °C(Predicted) | | density | 1.249±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | pka | -2.45±0.20(Predicted) | | form | Dark yellow-orange powder | | color | Yellow to Dark Orange | | λmax | 244nm(MeOH)(lit.) | | InChI | InChI=1S/C14H11NOS/c1-9(16)10-6-7-14-12(8-10)15-11-4-2-3-5-13(11)17-14/h2-8,15H,1H3 | | InChIKey | JWGBOHJGWOPYCL-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C2C(=C1)NC1=C(C=CC=C1)S2)C | | CAS DataBase Reference | 6631-94-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-52/53 | | Safety Statements | 60-61 | | WGK Germany | 3 | | HS Code | 2934309090 | | Storage Class | 11 - Combustible Solids |
| | 2-Acetylphenothiazine Usage And Synthesis |
| Description | 2-Acetylphenothiazine (2-APT) is a selective, cell-active inhibitor of NADPH oxidase 1 (NOX1) that blocks the generation of reactive oxygen species (ROS) in HT-29 cells with an IC50 value of 0.129 μM. It does not affect xanthine oxidase-dependent or mitochondrial ROS generation. 2-APT prevents ROS-dependent formation of ECM-degrading invadopodia in colon cancer cells. It also abolishes collagen-induced superoxide production by platelets (IC50 = 306 nM), preventing platelet aggregation and thrombus formation. 2-APT protects beta cells from cytokine-induced apoptosis by inhibiting NOX1. 2-APT can also activate the human transient receptor potential ankyrin 1 (TRPA1) nociceptor at 1-30 μM. | | Chemical Properties | Yellow white or green crystalline powder | | Uses | 2-Acetylphenothiazine is a potent and selective NADPH oxidase 1 (NOX1) inhibitor that blocks NOX1-dependent ROS generation. 2-Acetylphenothiazine has been shown to inhibit SrcYF-induced invadopodia formation in human DLD1 colon cancer cells. | | Uses | 2-Acetylphenothiazine was used as a NADPH oxidase (NOX) inhibitor in human platelet functional responses and intracellular signaling pathways. It was also used in the synthesis of 2-phenothiazin-2′-yl-cinchoninic acid derivatives. | | Definition | ChEBI: 1-(10H-phenothiazin-2-yl)ethanone is a member of phenothiazines. | | Synthesis | The general procedure for the synthesis of 2-acetylphenothiazine from 1-(3-phenylaminophenyl)-acetophenone was as follows: first, aniline and m-acetylphenol were added to the reaction vessel in a mass ratio of 1.2:1 and heated until dissolved. Subsequently, trifluoromethanesulfonic acid (the amount added was 0.025 times the mass of m-acetylphenol) was added and the dehydration reaction was carried out at 190 °C. The water generated was separated during the reaction. The reaction was terminated after 6 hours. Excess aniline was removed by distillation under reduced pressure to give a dark red solid, 3-acetyl diphenylamine (Compound A). Next, Compound A was added to a reaction vessel with sulfur (molar ratio of Compound A to sulfur is 1:2.3) and 250 mL of acetone (total mass of sulfur and monomers is 1 mole) and heated to dissolve to form a clear liquid. Then, iodine was added (the amount added was 0.0125 times the mass of compound A), and the reaction was stirred and refluxed at 170 °C. After 25 min, the reaction was essentially complete, the stirring was stopped, and the reaction was gradually cooled down to 120 °C, when a yellow and a black delamination was visible. The upper layer of yellow liquid was carefully decanted and a yellow solid was precipitated after cooling at room temperature. The crude product was recrystallized by ethanol-water mixed solvent to give a light yellow solid, i.e., the target product 2-acetylphenothiazine. The total yield in this embodiment was 90.5% and the HPLC purity was 99.7%. | | IC 50 | NOX1 | | References | [1] Patent: CN105461655, 2016, A. Location in patent: Paragraph 0033
[2] Patent: CN105481793, 2016, A. Location in patent: Paragraph 0038; 0041 |
| | 2-Acetylphenothiazine Preparation Products And Raw materials |
|