| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-(3-Furyl)acrylic acid Basic information |
| Product Name: | 3-(3-Furyl)acrylic acid | | Synonyms: | TIMTEC-BB SBB004191;RARECHEM BK HC S197;Furan-3-acrylic acid;Furane-3-acrylicacid;3-Furanacrylic acid;3-furan-3-yl-acrylic acid;3-Furylacrylic acid;3-(3-Furanyl)-2-propenoic acid | | CAS: | 39244-10-5 | | MF: | C7H6O3 | | MW: | 138.12 | | EINECS: | | | Product Categories: | | | Mol File: | 39244-10-5.mol |  |
| | 3-(3-Furyl)acrylic acid Chemical Properties |
| Melting point | 155-158 °C(lit.) | | Boiling point | 261.4±15.0 °C(Predicted) | | density | 1.280±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform, Methanol | | form | Solid | | pka | 4.20±0.10(Predicted) | | color | Pale Yellow | | Water Solubility | Sparingly soluble in water (0.56 g/L at 25°C). | | BRN | 1306450 | | InChI | InChI=1S/C7H6O3/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9) | | InChIKey | JHAPZUDWRRBZHZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C=CC1C=COC=1 | | CAS DataBase Reference | 39244-10-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2932990090 |
| | 3-(3-Furyl)acrylic acid Usage And Synthesis |
| Uses | 3-(3-Furyl)acrylic acid is used as an intermediate in chemical research and pharmaceuticals. | | Synthesis | To 12 mL of pyridine, 10.0 g of 3-furaldehyde and 15.0 g of malonic acid were added and heated with stirring at 80°C to 90°C for 2 hours. Upon completion of the reaction, the reaction solution was poured into ice water and the pH was adjusted to weakly acidic with 1 N hydrochloric acid. The precipitated crystals were collected by filtration, dissolved in ethyl acetate and the organic phase was washed with 1 N hydrochloric acid. The organic layer was dried with anhydrous magnesium sulfate and concentrated under reduced pressure. The residue was recrystallized by ethyl acetate-hexane mixed solvent to give 11.78 g (82% yield) of 3-(3-furyl)acrylic acid. The product was characterized by 1H-NMR (CDCl3): δ 7.70-7.67 (m, 2H), 7.45 (s, 1H), 6.62-6.61 (m, 1H), 6.16 (d, J = 15.8 Hz, 1H). Mass spectral analysis showed m/e: 138 (M+, base peak). | | References | [1] Organic and Biomolecular Chemistry, 2010, vol. 8, # 24, p. 5483 - 5485
[2] ChemMedChem, 2018, vol. 13, # 18, p. 1972 - 1977
[3] Heterocycles, 1984, vol. 22, # 8, p. 1747 - 1757
[4] Patent: EP1724267, 2006, A1. Location in patent: Page/Page column 128
[5] Patent: WO2016/37578, 2016, A1. Location in patent: Page/Page column 111 |
| | 3-(3-Furyl)acrylic acid Preparation Products And Raw materials |
|