| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Hydroxy-5-(trifluoromethoxy)benzoic acid Basic information |
| | 2-Hydroxy-5-(trifluoromethoxy)benzoic acid Chemical Properties |
| Melting point | 130-132 | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C8H5F3O4/c9-8(10,11)15-4-1-2-6(12)5(3-4)7(13)14/h1-3,12H,(H,13,14) | | InChIKey | HNYMLXYADOZCNY-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(OC(F)(F)F)=CC=C1O | | CAS DataBase Reference | 129644-57-1(CAS DataBase Reference) |
| | 2-Hydroxy-5-(trifluoromethoxy)benzoic acid Usage And Synthesis |
| | 2-Hydroxy-5-(trifluoromethoxy)benzoic acid Preparation Products And Raw materials |
|