| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 3-Methylglutarylcarnitine Basic information |
| Product Name: | 3-Methylglutarylcarnitine | | Synonyms: | 5-(4-hydroxy-4-oxo-1-trimethylazaniumylbutan-2-yl)oxy-3-methyl-5-oxopentanoate;5-[1-carboxy-3-(trimethylazaniumyl)propan-2-yl]oxy-3-methyl-5-oxopentanoate;3-Methylglutaryl-L-carnitine;3-Methylglutarylcarnitine | | CAS: | 102673-95-0 | | MF: | C13H24ClNO6 | | MW: | 325.79 | | EINECS: | | | Product Categories: | | | Mol File: | 102673-95-0.mol |  |
| | 3-Methylglutarylcarnitine Chemical Properties |
| storage temp. | -20°C | | form | paste | | InChI | 1S/C13H23NO6/c1-9(5-11(15)16)6-13(19)20-10(7-12(17)18)8-14(2,3)4/h9-10H,5-8H2,1-4H3,(H-,15,16,17,18) | | InChIKey | HFCPFJNSBPQJDP-UHFFFAOYSA-N | | SMILES | C[N+](C)(C)C[C@H](OC(CC(C)CC(O)=O)=O)CC([O-])=O |
| Storage Class | 10 - Combustible liquids |
| | 3-Methylglutarylcarnitine Usage And Synthesis |
| Uses | 3-Methylglutarylcarnitine is derived from DL-Carnitine Benzyl Ester Chloride (C184135), which is an intermediate in the synthesis of 3-Hydroxybutyrylcarnitine Hydrochloride (H830900), a reagent used to study acylcarnitine profile in thyroid disease. | | Biological Activity | 3-Me-Glutaryl Carnitine metabolite may be found in urine samples. The detection of 3-methylglutarylcarnitine and other metabolites may play a role in a treatment strategy for carnitine deficiency. |
| | 3-Methylglutarylcarnitine Preparation Products And Raw materials |
|