| Company Name: |
ChemeGen Gold |
| Tel: |
18818260767 |
| Email: |
2625930290@qq.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-carboxamide Basic information |
| Product Name: | 1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-carboxamide | | Synonyms: | 1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-carboxamide;Rufinamide-[d2, 15N];Rufinamide 15N D2Q: What is
Rufinamide 15N D2 Q: What is the CAS Number of
Rufinamide 15N D2 Q: What is the storage condition of
Rufinamide 15N D2 Q: What are the applications of
Rufinamide 15N D2;1-((2,6-difluorophenyl)methyl-d2)-1H-1,2,3-triazole-1-15N-4-carboxamide;15N,D2-Rufinamide;Rufinamide-[D2, 15N] (Standard) | | CAS: | 1795037-48-7 | | MF: | C10H6D2F2N4O | | MW: | 240.205849956 | | EINECS: | | | Product Categories: | | | Mol File: | 1795037-48-7.mol | ![1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-carboxamide Structure](CAS/20180601/GIF/1795037-48-7.gif) |
| | 1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-carboxamide Chemical Properties |
| storage temp. | -20°C | | solubility | Acetonitrile: slightly soluble,DMSO: slightly soluble | | form | A solid | | InChI | InChI=1S/C10H8F2N4O/c11-7-2-1-3-8(12)6(7)4-16-5-9(10(13)17)14-15-16/h1-3,5H,4H2,(H2,13,17)/i4D2 | | InChIKey | POGQSBRIGCQNEG-APZFVMQVSA-N | | SMILES | N1(C([2H])([2H])C2=C(F)C=CC=C2F)C=C(C(N)=O)N=N1 |
| | 1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-carboxamide Usage And Synthesis |
| Uses | Labelled Rufinamide (R701552). Antiepileptic triazole derivative which decreases firing by neurons at sodium channels. Anticonvulsant. |
| | 1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-carboxamide Preparation Products And Raw materials |
|