| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4,5-Diphenyl-2-mercaptooxazole manufacturers
|
| | 4,5-Diphenyl-2-mercaptooxazole Basic information |
| Product Name: | 4,5-Diphenyl-2-mercaptooxazole | | Synonyms: | 4-Oxazoline-2-thione, 4,5-diphenyl-;4,5-DIPHENYL-2-MERCAPTOBENZOXAZOLE;4,5-DIPHENYL-2-OXAZOLETHIOL;4,5-DIPHENYLOXAZOLE-2-THIOL;4,5-DIPHENYL-4-OXAZOLINE-2-THIONE;4,5-DIPHENYL-OXAZOL-2-THIOL;4,5-DIPHENYL-1,3-OXAZOLE-2-THIOL;2 MERCAPTO-4,5-DIPHENYLOXAZOLE | | CAS: | 6670-13-9 | | MF: | C15H11NOS | | MW: | 253.32 | | EINECS: | 229-707-4 | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Oxazoles | | Mol File: | 6670-13-9.mol |  |
| | 4,5-Diphenyl-2-mercaptooxazole Chemical Properties |
| Melting point | 254-257 °C(lit.) | | Boiling point | 390.6±52.0 °C(Predicted) | | density | 1.1949 (rough estimate) | | refractive index | 1.7500 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 8.15±0.60(Predicted) | | color | White to Light yellow | | Sensitive | Air Sensitive | | InChI | 1S/C15H11NOS/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H,16,18) | | InChIKey | NYQSTRUSYDZNHC-UHFFFAOYSA-N | | SMILES | Sc1nc(-c2ccccc2)c(o1)-c3ccccc3 | | CAS DataBase Reference | 6670-13-9(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | RIDADR | UN 3335 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4,5-Diphenyl-2-mercaptooxazole Usage And Synthesis |
| Chemical Properties | light yellow crystalline powder |
| | 4,5-Diphenyl-2-mercaptooxazole Preparation Products And Raw materials |
|