| Company Name: |
Jay Chemicals Gold |
| Tel: |
13732234254 |
| Email: |
yogesh.dama@jaychemicals.co.in |
| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
2-Amino-6-thiocyanobenzothiazole manufacturers
|
| | 2-Amino-6-thiocyanobenzothiazole Basic information |
| | 2-Amino-6-thiocyanobenzothiazole Chemical Properties |
| Melting point | 194-197 °C (lit.) | | Boiling point | 435.9±37.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 2.82±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C8H5N3S2/c9-4-12-5-1-2-6-7(3-5)13-8(10)11-6/h1-3H,(H2,10,11) | | InChIKey | FVNSRFMQXKMHTQ-UHFFFAOYSA-N | | SMILES | S(C1C=C2SC(N)=NC2=CC=1)C#N | | CAS DataBase Reference | 7170-77-6(CAS DataBase Reference) | | EPA Substance Registry System | Thiocyanic acid, 2-amino-6-benzothiazolyl ester (7170-77-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2934208090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Amino-6-thiocyanobenzothiazole Usage And Synthesis |
| Uses | 6-Thiocyanatobenzo[d]thiazol-2-amine is useful in the synthesis of the potent and Selective MET Kinase Inhibitor. |
| | 2-Amino-6-thiocyanobenzothiazole Preparation Products And Raw materials |
|