|
|
| | 2-HYDROXY-1,3,5-BENZENETRICARBALDEHYDE Basic information | | Uses |
| Product Name: | 2-HYDROXY-1,3,5-BENZENETRICARBALDEHYDE | | Synonyms: | 2-HYDROXY-1,3,5-BENZENETRICARBALDEHYDE;2-Hydroxybenzene-1,3,5-tricarbaldehyde;2-HYDROXYBENZENE-1,3,5-TRICARBOXALDEHYDE;1,3,5-Benzenetricarboxaldehyde,2-hydroxy-|||;1,3,5-Benzenetricarboxaldehyd;2-Hydroxy-1,3,5-benzenetricarboxaldehyde;2-hydroxy-1,3,5-triformylbenzene;2-hydroxy-1,3,5-benzenetrialdehyde | | CAS: | 81502-74-1 | | MF: | C9H6O4 | | MW: | 178.14 | | EINECS: | | | Product Categories: | | | Mol File: | 81502-74-1.mol |  |
| | 2-HYDROXY-1,3,5-BENZENETRICARBALDEHYDE Chemical Properties |
| Melting point | 179 °C | | Boiling point | 282.9±40.0 °C(Predicted) | | density | 1.449±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 4.20±0.23(Predicted) | | color | White to Yellow | | λmax | 335nm(EtOH)(lit.) | | InChI | InChI=1S/C9H6O4/c10-3-6-1-7(4-11)9(13)8(2-6)5-12/h1-5,13H | | InChIKey | HKAZHQGKWVMFHP-UHFFFAOYSA-N | | SMILES | C1(C=O)=CC(C=O)=CC(C=O)=C1O |
| HazardClass | IRRITANT | | HS Code | 2912490090 |
| | 2-HYDROXY-1,3,5-BENZENETRICARBALDEHYDE Usage And Synthesis |
| Uses | 2-Hydroxy-1,3,5-benzyltricarboxaldehyde is an aldehyde derivative that can be used as an organic reagent. | | Chemical Properties | 2-Hydroxy- 1,3,5-benzenetricarbaldehyde has a very limited solubility in
most organic solvents and in water. It dissolves well in DMSO and in hot DMF,
and the latter can be used as a recrystallization solvent. While the trialdehyde 3 is
colorless in its free acid form, its anion absorbs light in the visible region giving
the compound a yellow coloration in solutions when dissociation can occur. The
yellow sodium salt of 2-hydroxy- 1,3,5-benzenetricarbaldehyde is only slightly
soluble in water. | | Synthesis | 2-Hydroxybenzene-1,3,5-tricarbaldehyde is synthesized from phenol or 4-hydroxybenzaldehyde[1].
 | | References | [1] A. ANDERSON. A Convenient One-Step Synthesis of 2-Hydroxy-1,3,5-Benzenetricarbaldehyde[J]. Synthetic Communications, 2000. DOI:10.1080/00397910008086933. |
| | 2-HYDROXY-1,3,5-BENZENETRICARBALDEHYDE Preparation Products And Raw materials |
|