Tetraethylammonium hydrogensulfate manufacturers
|
| | Tetraethylammonium hydrogensulfate Basic information |
| | Tetraethylammonium hydrogensulfate Chemical Properties |
| Melting point | 243-245 °C | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | White to off-white | | Odor | Odorless | | Water Solubility | Soluble in water | | λmax | λ: 210 nm Amax: 0.05 λ: 220 nm Amax: 0.04 λ: 230 nm Amax: 0.03 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 | | BRN | 6590581 | | InChI | 1S/C8H20N.H2O4S/c1-5-9(6-2,7-3)8-4;1-5(2,3)4/h5-8H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1 | | InChIKey | CREVBWLEPKAZBH-UHFFFAOYSA-M | | SMILES | OS([O-])(=O)=O.CC[N+](CC)(CC)CC | | CAS DataBase Reference | 16873-13-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HS Code | 29239000 | | Storage Class | 11 - Combustible Solids |
| | Tetraethylammonium hydrogensulfate Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Tetraethylammonium Hydrogensulfate is catalyst; used in method for preparing siloxane copolycarbonate with improved transparency and excellent low-temperature impact resistance. |
| | Tetraethylammonium hydrogensulfate Preparation Products And Raw materials |
|