- ACHE-IN-38
-
- $38.00
-
2026-07-27
- CAS:120014-30-4
- Purity: 99.78%
- Supply Ability: 10g
|
| | 5,6-Dimethoxy-2-(piperidin-4-yl)methylene-indan-1-one Basic information |
| | 5,6-Dimethoxy-2-(piperidin-4-yl)methylene-indan-1-one Chemical Properties |
| Melting point | 258-260°C (dec.) | | Boiling point | 454.1±45.0 °C(Predicted) | | density | 1.116 | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | pka | 10.57±0.10(Predicted) | | InChI | InChI=1S/C17H23NO3/c1-20-15-9-12-8-13(7-11-3-5-18-6-4-11)17(19)14(12)10-16(15)21-2/h9-11,13,18H,3-8H2,1-2H3 | | InChIKey | PGBZORAISITZTF-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(OC)C(OC)=C2)CC1CC1CCNCC1 | | CAS DataBase Reference | 120014-30-4(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 |
| | 5,6-Dimethoxy-2-(piperidin-4-yl)methylene-indan-1-one Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | 5,6-Dimethoxy-2-[(4-piperidyl)methyl]indan-1-one is an impurity of Donepezil (D531750), an inhibitor of acetylcholinesterase. | | Uses | An impurity of Donepezil (D531750). | | Definition | ChEBI: Donepezil metabolite M4 is a member of indanones. |
| | 5,6-Dimethoxy-2-(piperidin-4-yl)methylene-indan-1-one Preparation Products And Raw materials |
|