| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | D-Glucuronic acid sodium salt monohydrate Basic information |
| Product Name: | D-Glucuronic acid sodium salt monohydrate | | Synonyms: | D-Glucuronic acid,sodium salt, hydrate (1:1:1);D(+)-GLUCURONIC ACID SODIUM SALT MONOHYDRATE;D-GLCA, SODIUM SALT MONOHYDRATE;D-GLUCURONIC ACID SODIUM CELL*CULTURE TE STED;SODIUM D-GLUCURONATE MONOHYDRATE;SODIUM GLUCURONATE MONOHYDRATE;D-Glucuronic acid monohydrate sodium salt;D(+)-GLUCURONIC ACID SODIUM SALT MONOHYD | | CAS: | 207300-70-7 | | MF: | C6H10O7.H2O.Na | | MW: | 235.14 | | EINECS: | 239-065-7 | | Product Categories: | | | Mol File: | 207300-70-7.mol |  |
| | D-Glucuronic acid sodium salt monohydrate Chemical Properties |
| Melting point | 134-140 °C | | RTECS | LZ8950000 | | storage temp. | Store below +30°C. | | solubility | water: 50 mg/mL, clear, colorless to light yellow | | form | powder | | color | White | | biological source | synthetic (organic
Organic) | | Water Solubility | water: 50mg/mL, clear, colorless to light yellow | | BRN | 4218577 | | InChI | InChI=1/C6H10O7.Na.H2O/c7-1-2(8)3(9)4(10)5(11)6(12)13;;/h1-5,8-11H,(H,12,13);;1H2/q;+1;/p-1/t2-,3+,4-,5-;;/s3 | | InChIKey | ICQRTPLATMRWJI-HOSFRJHGNA-M | | SMILES | [Na+].O=C[C@@H]([C@H]([C@@H]([C@@H](C([O-])=O)O)O)O)O.[H]O[H] |&1:3,4,5,6,r| |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2932 99 00 | | Storage Class | 11 - Combustible Solids |
| | D-Glucuronic acid sodium salt monohydrate Usage And Synthesis |
| Uses | D-Glucuronic Acid, Sodium Salt, Hydrate (1:1:1) is an amorphous sucrose matrix, which has water sorption, glass transition, and protein-stabilizing behavior when combined with various materials. | | Biological Activity | Glucuronic acid is a carboxylic acid which in involved in the process of glucuronidation, where glucuronic acid is linked to a molecule to allow for more efficient transport due its highly water-soluble nature. Most often it is used to rid the body of toxins or to aid in the delivery of drugs or hormones. | | IC 50 | Human Endogenous Metabolite |
| | D-Glucuronic acid sodium salt monohydrate Preparation Products And Raw materials |
|