- Sodium Glucuronate
-
- $30.00 / 1KG
-
2025-03-21
- CAS:14984-34-0
- Min. Order: 1KG
- Purity: 99.99%
- Supply Ability: 200
|
| | D-Glucuronic acid sodium salt Basic information |
| Product Name: | D-Glucuronic acid sodium salt | | Synonyms: | Sodium (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate;Sodium glucuronate Injections grade;D-Glucuronic acid, monosodium salt;D-GLUCURONICACIDSODIUMMONOHYDRATE;D-Glucuronic acid, monosodium salt (9CI);Glucuronic acid, monosodium salt, D- (8CI);D-GLUCURONIC ACID NA-SALT;D-GLUCURONIC ACID SODIUM SALT | | CAS: | 14984-34-0 | | MF: | C6H11NaO7 | | MW: | 218.14 | | EINECS: | 239-065-7 | | Product Categories: | Dextrins、Sugar & Carbohydrates;carbohydrate | | Mol File: | 14984-34-0.mol |  |
| | D-Glucuronic acid sodium salt Chemical Properties |
| Melting point | 138 °C (dec.)(lit.) | | form | Crystalline Powder | | color | White to off-white | | PH | pH (50g/l, 25℃) : 6.0～8.0 | | BRN | 4218577 | | Cosmetics Ingredients Functions | HUMECTANT
SKIN CONDITIONING | | InChI | InChI=1/C6H10O7.Na.H/c7-1-2(8)3(9)4(10)5(11)6(12)13;;/h1-5,8-11H,(H,12,13);;/t2-,3+,4-,5-;;/s3 | | InChIKey | LZYWWLODKHLDEI-HOSFRJHGNA-N | | SMILES | [C@@H](O)([C@H](O)C(=O)O)[C@H](O)[C@@H](O)C=O.[NaH] |&1:0,2,7,9,r| | | CAS DataBase Reference | 14984-34-0(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | LZ8950000 | | F | 21 | | HS Code | 29329990 |
| | D-Glucuronic acid sodium salt Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Definition | ChEBI: Sodium glucuronate is an organic molecular entity. |
| | D-Glucuronic acid sodium salt Preparation Products And Raw materials |
|