|
|
| | NE-CARBOXYMETHYL-L-LYSINE Basic information |
| | NE-CARBOXYMETHYL-L-LYSINE Chemical Properties |
| Melting point | 280°C (dec.) | | Boiling point | 428.9±45.0 °C(Predicted) | | density | 1?+-.0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | Water (Slightly, Heated, Sonicated) | | form | Solid | | pka | 2.35±0.10(Predicted) | | color | White to Pale Beige | | InChI | InChI=1S/C8H16N2O4/c9-6(8(13)14)3-1-2-4-10-5-7(11)12/h6,10H,1-5,9H2,(H,11,12)(H,13,14)/t6-/m0/s1 | | InChIKey | NUXSIDPKKIEIMI-LURJTMIESA-N | | SMILES | C(O)(=O)[C@H](CCCCNCC(O)=O)N |
| | NE-CARBOXYMETHYL-L-LYSINE Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | CEL and CML are two stable, nonenzymatic chemical modifications of protein lysine residues resulting from glycation and oxidation reactions. | | Definition | ChEBI: An L-lysine derivative with a carboxymethyl substituent at the N6-position. |
| | NE-CARBOXYMETHYL-L-LYSINE Preparation Products And Raw materials |
|