|
|
| | BUTTPARK 120\07-77 Basic information |
| Product Name: | BUTTPARK 120\07-77 | | Synonyms: | BUTTPARK 120\07-77;6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one;6-(TRIFLUOROMETHYL)-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE;3,4-Dihydro-3-oxo-6-(trifluoromethyl)-2H-1,4-benzoxazine, 6-(Trifluoromethyl)-4H-benzo[b][1,4]oxazin-3-one;6-(Trifluoromethyl)-2H-1,4-benzoxazin-3(4H)-one 95%;6-(Trifluoromethyl)-2H-1,4-benzoxazin-3(4H)-one95%;6-(Trifluoromethyl)-2He-1,4-benzoxazin-3(4H)-on;6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazin-3-one | | CAS: | 189940-04-3 | | MF: | C9H6F3NO2 | | MW: | 217.14 | | EINECS: | | | Product Categories: | | | Mol File: | 189940-04-3.mol |  |
| | BUTTPARK 120\07-77 Chemical Properties |
| Boiling point | 315.2±42.0 °C(Predicted) | | density | 1.416±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 11.91±0.20(Predicted) | | form | solid | | Appearance | Off-white to light brown Solid | | InChI | 1S/C9H6F3NO2/c10-9(11,12)5-1-2-7-6(3-5)13-8(14)4-15-7/h1-3H,4H2,(H,13,14) | | InChIKey | LRZVYXWBGNCLDB-UHFFFAOYSA-N | | SMILES | O=C1NC2=CC(C(F)(F)F)=CC=C2OC1 |
| WGK Germany | WGK 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | BUTTPARK 120\07-77 Usage And Synthesis |
| | BUTTPARK 120\07-77 Preparation Products And Raw materials |
|