|
|
| | 4-NITROHIPPURIC ACID Basic information |
| | 4-NITROHIPPURIC ACID Chemical Properties |
| Melting point | 131-133 °C(lit.) | | Boiling point | 365.56°C (rough estimate) | | density | 1.4656 (rough estimate) | | refractive index | 1.5570 (estimate) | | storage temp. | Storage temp. 2-8°C | | pka | 3.31±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C9H8N2O5/c12-8(13)5-10-9(14)6-1-3-7(4-2-6)11(15)16/h1-4H,5H2,(H,10,14)(H,12,13) | | InChIKey | XCMUCRMMVDSVEL-UHFFFAOYSA-N | | SMILES | C(O)(=O)CNC(=O)C1=CC=C([N+]([O-])=O)C=C1 | | CAS DataBase Reference | 2645-07-0(CAS DataBase Reference) | | EPA Substance Registry System | Glycine, N-(4-nitrobenzoyl)- (2645-07-0) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | MC0785000 | | HS Code | 29242990 |
| | 4-NITROHIPPURIC ACID Usage And Synthesis |
| Chemical Properties | YELLOW GRANULES | | General Description | Yellow powder. | | Air & Water Reactions | Slightly soluble in water. | | Reactivity Profile | A nitrated amide and organic acid. Acts as a weak acid in aqueous solution. Organic amides/imides react with azo and diazo compounds to generate toxic gases. Flammable gases are formed by the reaction of organic amides/imides with strong reducing agents. Amides are very weak bases (weaker than water). Imides are less basic yet and in fact react with strong bases to form salts. That is, they can react as acids. Mixing amides with dehydrating agents such as P2O5 or SOCl2 generates the corresponding nitrile. The combustion of these compounds generates mixed oxides of nitrogen (NOx). | | Fire Hazard | Flash point data for 4-NITROHIPPURIC ACID are not available. 4-NITROHIPPURIC ACID is probably combustible. |
| | 4-NITROHIPPURIC ACID Preparation Products And Raw materials |
|