| Company Name: |
RYSS TECH LTD |
| Tel: |
400-188-0725 +86 21 34310725 13611771617 |
| Email: |
|
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-Cyclohexyl-3-(2-morpholinoethyl)thiourea Basic information |
| | 1-Cyclohexyl-3-(2-morpholinoethyl)thiourea Chemical Properties |
| Melting point | 125-126 °C(lit.) | | density | 1.0836 (rough estimate) | | refractive index | 1.6740 (estimate) | | form | powder | | InChI | 1S/C13H25N3OS/c18-13(15-12-4-2-1-3-5-12)14-6-7-16-8-10-17-11-9-16/h12H,1-11H2,(H2,14,15,18) | | InChIKey | AKYYGBUVZFGJNI-UHFFFAOYSA-N | | SMILES | S=C(NCCN1CCOCC1)NC2CCCCC2 | | EPA Substance Registry System | N-Cyclohexyl-N'-[2-(4-morpholinyl)ethyl]thiourea (21545-54-0) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | YS7650000 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | 1-Cyclohexyl-3-(2-morpholinoethyl)thiourea Usage And Synthesis |
| Chemical Properties | white to off-white or beige powder | | Synthesis Reference(s) | The Journal of Organic Chemistry, 21, p. 439, 1956 DOI: 10.1021/jo01110a017 |
| | 1-Cyclohexyl-3-(2-morpholinoethyl)thiourea Preparation Products And Raw materials |
|