|
|
| | 2,3-DIPHENYL-1,3-BUTADIENE Basic information |
| Product Name: | 2,3-DIPHENYL-1,3-BUTADIENE | | Synonyms: | 2,3-diphenylbutadiene;benzene,1,1’-[1,2-bis(methylene)-1,2-ethanediyl]bis-;2,3-DIPHENYL-1,3-BUTADIENE;1,1'-[1,2-bis(methylene)-1,2-ethanediyl]bis-Benzene | | CAS: | 2548-47-2 | | MF: | C16H14 | | MW: | 206.28 | | EINECS: | | | Product Categories: | Acyclic;Alkenes;Organic Building Blocks | | Mol File: | 2548-47-2.mol |  |
| | 2,3-DIPHENYL-1,3-BUTADIENE Chemical Properties |
| Melting point | 40-45 °C | | Boiling point | 150-170 °C(Press: 10 Torr) | | density | 0.987±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | InChI | InChI=1S/C16H14/c1-13(15-9-5-3-6-10-15)14(2)16-11-7-4-8-12-16/h3-12H,1-2H2 | | InChIKey | LGLDSEPDYUTBNZ-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=C)C(C1=CC=CC=C1)=C |
| | 2,3-DIPHENYL-1,3-BUTADIENE Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 50, p. 3170, 1985 DOI: 10.1021/jo00217a031 |
| | 2,3-DIPHENYL-1,3-BUTADIENE Preparation Products And Raw materials |
|