| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Cyclopentanone-2,2,5,5-d4 Basic information |
| Product Name: | Cyclopentanone-2,2,5,5-d4 | | Synonyms: | CYCLOPENTANONE-2,2,5,5-D4, 98 ATOM % D;(2,2,5,5-2H4)Cyclopentan-1-one;2,2,5,5-tetradeuteriocyclopentan-1-one;Yclopentanone-2,2,5,5-d4;Cyclopentanone-2,2,5,5-d4(6CI,8CI,9CI);Cyclopentanone-2,2,5,5-d?;Cyclopentanone-2,2,5,5-d4;Cyclopentanone-2,2,5,5-d4 | | CAS: | 3997-89-5 | | MF: | C5H4D4O | | MW: | 88.14 | | EINECS: | | | Product Categories: | Alphabetical Listings;C;Stable Isotopes | | Mol File: | 3997-89-5.mol |  |
| | Cyclopentanone-2,2,5,5-d4 Chemical Properties |
| Melting point | −51 °C(lit.) | | Boiling point | 130-131 °C(lit.) | | density | 0.996 g/mL at 25 °C | | refractive index | n20/D 1.437(lit.) | | Fp | 87 °F | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | Sensitive | Air Sensitive | | InChI | 1S/C5H8O/c6-5-3-1-2-4-5/h1-4H2/i3D2,4D2 | | InChIKey | BGTOWKSIORTVQH-KHORGVISSA-N | | SMILES | [2H]C1([2H])CCC([2H])([2H])C1=O |
| Hazard Codes | Xn | | Risk Statements | 10-20/21/22-36/37-41 | | Safety Statements | 16-26-36 | | RIDADR | UN 2245 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2 |
| | Cyclopentanone-2,2,5,5-d4 Usage And Synthesis |
| Uses | Cyclopentanone-2,2,5,5-d4 (CAS# 3997-89-5) is a useful isotopically labeled research compound. |
| | Cyclopentanone-2,2,5,5-d4 Preparation Products And Raw materials |
|