|
|
| | Isopropylxanthic disulfide Basic information |
| Product Name: | Isopropylxanthic disulfide | | Synonyms: | bis(1-methylethyl)ester-thioperoxydicarbonicaci;bis(1-methylethyl)esterthioperoxydicarbonicacid;bis(2-propyl)dixanthogen;bis(isopropylxanthogen)disulfide;bis(o-isopropylxanthyl)disulfide;Bis-iso-propylxanthogenate;diisopropyldixanthogen;diisopropylxanthogenatedisulfide | | CAS: | 105-65-7 | | MF: | C8H14O2S4 | | MW: | 270.46 | | EINECS: | 203-319-5 | | Product Categories: | | | Mol File: | 105-65-7.mol |  |
| | Isopropylxanthic disulfide Chemical Properties |
| Melting point | 54-56 °C(lit.) | | Boiling point | 316.5±25.0 °C(Predicted) | | density | 1.275±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 20℃ | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Light Yellow | | Water Solubility | 6.7μg/L at 20℃ | | InChI | InChI=1S/C8H14O2S4/c1-5(2)9-7(11)13-14-8(12)10-6(3)4/h5-6H,1-4H3 | | InChIKey | ZWWQICJTBOCQLA-UHFFFAOYSA-N | | SMILES | C(=S)(OC(C)C)SSC(=S)OC(C)C | | LogP | 5.72 at 40℃ | | CAS DataBase Reference | 105-65-7(CAS DataBase Reference) | | EPA Substance Registry System | Thioperoxydicarbonic acid ([(HO)C(S)]2S2), bis(1-methylethyl) ester (105-65-7) |
| Hazard Codes | Xi | | Risk Statements | 31-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | XM6844300 | | TSCA | TSCA listed |
| | Isopropylxanthic disulfide Usage And Synthesis |
| Chemical Properties | Industrial product is light yellow to greenish crystalline particles. Relative density(20/4℃)1.28.Melting point≥52℃. Insoluble in water, soluble in ethanol, acetone, benzene, gasoline and other organic solvents. | | Uses | Diisopropylxanthogen disulfide is an inhibitor of Junin virus (JUNV), the causative agent of Argentine hemorrhagic fever. A toxic chemical compound. | | Hazard | Moderately toxic by ingestion. | | Flammability and Explosibility | Not classified |
| | Isopropylxanthic disulfide Preparation Products And Raw materials |
|